Products 1820710-55-1
CAS 1820710-55-1 appears in our catalog under these names: 2–(2，6–dimethylphenyl)–2，2–difluoroethan–1–ol, 2-(2，6-dimethylphenyl)-2，2-difluoroethan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 5g.
2-(2,6-dimethylphenyl)-2,2-difluoroethanol (CAS 1820710-55-1) is a chemical compound with the molecular formula C10H12F2O and a molecular weight of 186.20 g/mol. IUPAC name: 2-(2,6-dimethylphenyl)-2,2-difluoroethanol. InChIKey: IPQALEVUQUIJRD-UHFFFAOYSA-N.
| Molecular formula | C10H12F2O |
|---|---|
| Molecular weight | 186.20 g/mol |
| IUPAC name | 2-(2,6-dimethylphenyl)-2,2-difluoroethanol |
| InChIKey | IPQALEVUQUIJRD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)C(CO)(F)F |
Computed by PubChem (NCBI)