Products 710311-03-8
CAS 710311-03-8 appears in our catalog under these names: 4-(3,5-Dimethoxybenzamido)-2-hydroxybenzoic acid, 95%, 95%, 4-(3,5-dimethoxybenzamido)-2-hydroxybenzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid (CAS 710311-03-8) is a chemical compound with the molecular formula C16H15NO6 and a molecular weight of 317.29 g/mol. IUPAC name: 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid. InChIKey: FGBCKOTUEAURJR-UHFFFAOYSA-N.
| Molecular formula | C16H15NO6 |
|---|---|
| Molecular weight | 317.29 g/mol |
| IUPAC name | 4-[(3,5-dimethoxybenzoyl)amino]-2-hydroxybenzoic acid |
| InChIKey | FGBCKOTUEAURJR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C(=O)NC2=CC(=C(C=C2)C(=O)O)O)OC |
Computed by PubChem (NCBI)