Products 1820736-57-9
CAS 1820736-57-9 is the registry number for Ethyl 1-isopropyl-1,3-benzodiazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 1-propan-2-ylbenzimidazole-5-carboxylate (CAS 1820736-57-9) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: ethyl 1-propan-2-ylbenzimidazole-5-carboxylate. InChIKey: REWGFANBMHYIAX-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | ethyl 1-propan-2-ylbenzimidazole-5-carboxylate |
| InChIKey | REWGFANBMHYIAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(C=N2)C(C)C |
Computed by PubChem (NCBI)