CAS 18213-77-9 is the registry number for 1-Methyl-5-nitro-1H-pyrazole-4-carboxylic acid. Offered by: Fluorochem. Available pack sizes: 1g, 5g, 10g.
1-methyl-5-nitropyrazole-4-carboxylic acid (CAS 18213-77-9) is a chemical compound with the molecular formula C5H5N3O4 and a molecular weight of 171.11 g/mol. IUPAC name: 1-methyl-5-nitropyrazole-4-carboxylic acid. InChIKey: XLSBYMROSSRRAV-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4 |
|---|---|
| Molecular weight | 171.11 g/mol |
| IUPAC name | 1-methyl-5-nitropyrazole-4-carboxylic acid |
| InChIKey | XLSBYMROSSRRAV-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)