Products 1821757-56-5
CAS 1821757-56-5 appears in our catalog under these names: Clavulanic Acid Methyl-d3 Ester, >95% (HPLC), Clavulanic acid methyl ester-d3, 0.9973%. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg.
Trideuteriomethyl (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 1821757-56-5) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 216.21 g/mol. IUPAC name: trideuteriomethyl (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: HTABQNQMGKGBDT-QEYUTSQOSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 216.21 g/mol |
| IUPAC name | trideuteriomethyl (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | HTABQNQMGKGBDT-QEYUTSQOSA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)[C@H]1/C(=C/CO)/O[C@H]2N1C(=O)C2 |
Computed by PubChem (NCBI)