CAS 57943-82-5 appears in our catalog under these names: Methyl Clavulanate, Clavulanic Acid Methyl Ester, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg, 5mg.
Methyl (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 57943-82-5) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: methyl (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: HTABQNQMGKGBDT-NDFJAXRBSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | methyl (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | HTABQNQMGKGBDT-NDFJAXRBSA-N |
| SMILES | COC(=O)[C@H]1/C(=C/CO)/O[C@H]2N1C(=O)C2 |
Computed by PubChem (NCBI)