CAS 1821775-99-8 appears in our catalog under these names: (S)–1–(tert–Butoxycarbonyl)–3–methylpyrrolidine–3–carboxylic acid, (S)-1-(tert-Butoxycarbonyl)-3-methylpyrrolidine-3-carboxylic acid, 97%, 97%, (S)-1-(tert-Butoxycarbonyl)-3-methylpyrrolidine-3-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
(3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 1821775-99-8) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: DTLBJDMWGRKALK-NSHDSACASA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | DTLBJDMWGRKALK-NSHDSACASA-N |
| SMILES | C[C@@]1(CCN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)