CAS 2198242-27-0 is the registry number for (R)-1-(tert-Butoxycarbonyl)-3-methylpyrrolidine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 2198242-27-0) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: DTLBJDMWGRKALK-LLVKDONJSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (3R)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | DTLBJDMWGRKALK-LLVKDONJSA-N |
| SMILES | C[C@]1(CCN(C1)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)