CAS 1821819-87-7 is the registry number for (1S,2S)-2-(4-Chlorophenyl)cyclopentan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1S,2S)-2-(4-chlorophenyl)cyclopentan-1-ol (CAS 1821819-87-7) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: cis-(1S,2S)-2-(4-chlorophenyl)cyclopentan-1-ol. InChIKey: ARYRPLFQFILOCQ-QWRGUYRKSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | cis-(1S,2S)-2-(4-chlorophenyl)cyclopentan-1-ol |
| InChIKey | ARYRPLFQFILOCQ-QWRGUYRKSA-N |
| SMILES | C1C[C@H]([C@H](C1)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)