CAS 2372-05-6 is the registry number for Rel-(1R,2R)-2-(4-chlorophenyl)cyclopentan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Cis-(1R,2R)-2-(4-chlorophenyl)cyclopentan-1-ol (CAS 2372-05-6) is a chemical compound with the molecular formula C11H13ClO and a molecular weight of 196.67 g/mol. IUPAC name: cis-(1R,2R)-2-(4-chlorophenyl)cyclopentan-1-ol. InChIKey: ARYRPLFQFILOCQ-GHMZBOCLSA-N.
| Molecular formula | C11H13ClO |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | cis-(1R,2R)-2-(4-chlorophenyl)cyclopentan-1-ol |
| InChIKey | ARYRPLFQFILOCQ-GHMZBOCLSA-N |
| SMILES | C1C[C@@H]([C@@H](C1)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)