CAS 182198-35-2 appears in our catalog under these names: 4-Chloro-5-phenylthieno[2,3-d]pyrimidine, 95%, 4-Chloro-5-phenylthieno¬2,3-d|pyrimidine, 98% , 4-Chloro-5-phenylthieno[2,3-d]pyrimidine, 97%, 97%, 4-Chloro-5-phenyl-thieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-chloro-5-phenylthieno[2,3-d]pyrimidine (CAS 182198-35-2) is a chemical compound with the molecular formula C12H7ClN2S and a molecular weight of 246.72 g/mol. IUPAC name: 4-chloro-5-phenylthieno[2,3-d]pyrimidine. InChIKey: WONOKVSIDWOIGC-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2S |
|---|---|
| Molecular weight | 246.72 g/mol |
| IUPAC name | 4-chloro-5-phenylthieno[2,3-d]pyrimidine |
| InChIKey | WONOKVSIDWOIGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=C2C(=NC=N3)Cl |
Computed by PubChem (NCBI)