CAS 924068-56-4 is the registry number for 4-Chloro-2-(thiophen-3-yl)quinazoline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-chloro-2-thiophen-3-ylquinazoline (CAS 924068-56-4) is a chemical compound with the molecular formula C12H7ClN2S and a molecular weight of 246.72 g/mol. IUPAC name: 4-chloro-2-thiophen-3-ylquinazoline. InChIKey: NFTIZFGLNIBYCF-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2S |
|---|---|
| Molecular weight | 246.72 g/mol |
| IUPAC name | 4-chloro-2-thiophen-3-ylquinazoline |
| InChIKey | NFTIZFGLNIBYCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CSC=C3)Cl |
Computed by PubChem (NCBI)