CAS 214417-22-8 appears in our catalog under these names: 4-Chloro-2-phenylthieno[3,2-d]pyrimidine 95+%, 4-Chloro-2-phenylthieno[3,2-d]pyrimidine, 95+%, 95+%, 4-Chloro-2-phenylthieno[3,2-d]pyrimidine, 95+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-2-phenylthieno[3,2-d]pyrimidine (CAS 214417-22-8) is a chemical compound with the molecular formula C12H7ClN2S and a molecular weight of 246.72 g/mol. IUPAC name: 4-chloro-2-phenylthieno[3,2-d]pyrimidine. InChIKey: CXDKDIMCVLMEDW-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2S |
|---|---|
| Molecular weight | 246.72 g/mol |
| IUPAC name | 4-chloro-2-phenylthieno[3,2-d]pyrimidine |
| InChIKey | CXDKDIMCVLMEDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C(=N2)Cl)SC=C3 |
Computed by PubChem (NCBI)