Products 935278-69-6
CAS 935278-69-6 is the registry number for 2-(5-Chloro-2-thienyl)quinoxaline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-(5-chlorothiophen-2-yl)quinoxaline (CAS 935278-69-6) is a chemical compound with the molecular formula C12H7ClN2S and a molecular weight of 246.72 g/mol. IUPAC name: 2-(5-chlorothiophen-2-yl)quinoxaline. InChIKey: ZADDQAWYZOWPOY-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2S |
|---|---|
| Molecular weight | 246.72 g/mol |
| IUPAC name | 2-(5-chlorothiophen-2-yl)quinoxaline |
| InChIKey | ZADDQAWYZOWPOY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)C3=CC=C(S3)Cl |
Computed by PubChem (NCBI)