CAS 35970-79-7 is the registry number for 4-Chloro-6-phenylthieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
4-chloro-6-phenylthieno[2,3-d]pyrimidine (CAS 35970-79-7) is a chemical compound with the molecular formula C12H7ClN2S and a molecular weight of 246.72 g/mol. IUPAC name: 4-chloro-6-phenylthieno[2,3-d]pyrimidine. InChIKey: WJFATWIQZZNARY-UHFFFAOYSA-N.
| Molecular formula | C12H7ClN2S |
|---|---|
| Molecular weight | 246.72 g/mol |
| IUPAC name | 4-chloro-6-phenylthieno[2,3-d]pyrimidine |
| InChIKey | WJFATWIQZZNARY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(S2)N=CN=C3Cl |
Computed by PubChem (NCBI)