CAS 1822538-74-8 appears in our catalog under these names: 1-tert-Butyl 2-methyl 5-hydroxypiperidine-1,2-dicarboxylate, 96%, 1-tert-Butyl 2-methyl 5-hydroxypiperidine-1,2-dicarboxylate, 97%, 97%, 1-(tert-Butyl) 2-methyl 5-hydroxypiperidine-1,2-dicarboxylate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 25g, 5g, 100mg, 250mg, 500mg.
1-O-tert-butyl 2-O-methyl 5-hydroxypiperidine-1,2-dicarboxylate (CAS 1822538-74-8) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 5-hydroxypiperidine-1,2-dicarboxylate. InChIKey: SCKQPFVBRJQINF-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 5-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | SCKQPFVBRJQINF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CCC1C(=O)OC)O |
Computed by PubChem (NCBI)