Products 869564-46-5

CAS 869564-46-5 is the registry number for O1-tert-butyl O2-methyl cis-5-hydroxypiperidine-1,2-dicarboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate (CAS 869564-46-5) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate. InChIKey: SCKQPFVBRJQINF-IUCAKERBSA-N.

Identity
Molecular formulaC12H21NO5
Molecular weight259.30 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate
InChIKeySCKQPFVBRJQINF-IUCAKERBSA-N
SMILESCC(C)(C)OC(=O)N1C[C@H](CC[C@H]1C(=O)OC)O

Computed by PubChem (NCBI)