CAS 2139383-25-6 appears in our catalog under these names: 1-tert-butyl 2-methyl (2R,5R)-5-hydroxypiperidine-1,2-dicarboxylate, 97%, 97%, 1-(TERT-BUTYL) 2-METHYL (2R,5R)-5-HYDROXYPIPERIDINE-1,2-DICARBOXYLATE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2R,5R)-5-hydroxypiperidine-1,2-dicarboxylate (CAS 2139383-25-6) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,5R)-5-hydroxypiperidine-1,2-dicarboxylate. InChIKey: SCKQPFVBRJQINF-RKDXNWHRSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,5R)-5-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | SCKQPFVBRJQINF-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CC[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)