CAS 915976-32-8 appears in our catalog under these names: (2S,5S)-1-tert-Butyl 2-methyl 5-hydroxypiperidine-1,2-dicarboxylate, 95%, (2S,5S)–1–tert–Butyl 2–methyl 5–hydroxypiperidine–1,2–dicarboxylate, (2S,5S)-1-Tert-butyl-2-methyl5-hydroxypiperidine-1,2-dicarboxylate, 1,2-Piperidinedicarboxylic acid, 5-hydroxy-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S,5S)-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
1-O-tert-butyl 2-O-methyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate (CAS 915976-32-8) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate. InChIKey: SCKQPFVBRJQINF-IUCAKERBSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,5S)-5-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | SCKQPFVBRJQINF-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CC[C@H]1C(=O)OC)O |
Computed by PubChem (NCBI)