Products 1822570-85-3
CAS 1822570-85-3 is the registry number for 1-(Pyridin-3-yl)piperidine-2-carboxylic acid, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
1-pyridin-3-ylpiperidine-2-carboxylic acid (CAS 1822570-85-3) is a chemical compound with the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. IUPAC name: 1-pyridin-3-ylpiperidine-2-carboxylic acid. InChIKey: SYXIBOFYUSDGOK-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O2 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 1-pyridin-3-ylpiperidine-2-carboxylic acid |
| InChIKey | SYXIBOFYUSDGOK-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)