CAS 1822665-20-2 is the registry number for Ponatinib Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
4-(bromomethyl)-3-(trifluoromethyl)aniline (CAS 1822665-20-2) is a chemical compound with the molecular formula C8H7BrF3N and a molecular weight of 254.05 g/mol. IUPAC name: 4-(bromomethyl)-3-(trifluoromethyl)aniline. InChIKey: UBZPXHLHYOBOMW-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3N |
|---|---|
| Molecular weight | 254.05 g/mol |
| IUPAC name | 4-(bromomethyl)-3-(trifluoromethyl)aniline |
| InChIKey | UBZPXHLHYOBOMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)CBr |
Computed by PubChem (NCBI)