Products 1822756-03-5

CAS 1822756-03-5 is the registry number for Apremilast Impurity 71. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-amino-2-ethoxycarbonylbenzoic acid (CAS 1822756-03-5) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 3-amino-2-ethoxycarbonylbenzoic acid. InChIKey: MOKOKJFMEQGKAA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO4
Molecular weight209.20 g/mol
IUPAC name3-amino-2-ethoxycarbonylbenzoic acid
InChIKeyMOKOKJFMEQGKAA-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC=C1N)C(=O)O

Computed by PubChem (NCBI)