Products 182287-51-0

CAS 182287-51-0 is the registry number for 2-N-BOC-Amino-3-(4-tetrahydropyranyl)propionic acid, 95%. Offered by: Thermo Scientific (Acros). Available pack sizes: 500MG.

Structural formula: {0} (CAS {1})

2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-4-yl)propanoic acid (CAS 182287-51-0) is a chemical compound with the molecular formula C13H23NO5 and a molecular weight of 273.33 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-4-yl)propanoic acid. InChIKey: NKYZORHKIYSSEL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H23NO5
Molecular weight273.33 g/mol
IUPAC name2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(oxan-4-yl)propanoic acid
InChIKeyNKYZORHKIYSSEL-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC(CC1CCOCC1)C(=O)O

Computed by PubChem (NCBI)