Products 1823098-04-9
CAS 1823098-04-9 is the registry number for Methyl 3-amino-3-(2-chloro-6-methylphenyl)propanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-3-(2-chloro-6-methylphenyl)propanoate (CAS 1823098-04-9) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 3-amino-3-(2-chloro-6-methylphenyl)propanoate. InChIKey: CNDVFVPDSXJDLP-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 3-amino-3-(2-chloro-6-methylphenyl)propanoate |
| InChIKey | CNDVFVPDSXJDLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)C(CC(=O)OC)N |
Computed by PubChem (NCBI)