Products 1823315-67-8
CAS 1823315-67-8 appears in our catalog under these names: 2-(Benzyloxy)-3,6-difluorobenzaldehyde, 95%, 2-(Benzyloxy)-3,6-difluorobenzaldehyde, 98%, 2-(Benzyloxy)-3,6-difluorobenzaldehyde, ≥95%, ≥95%, 2-(Benzyloxy)-3,6-difluorobenzaldehyde. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
3,6-difluoro-2-phenylmethoxybenzaldehyde (CAS 1823315-67-8) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 3,6-difluoro-2-phenylmethoxybenzaldehyde. InChIKey: RZRGWHWDDCWVKR-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 3,6-difluoro-2-phenylmethoxybenzaldehyde |
| InChIKey | RZRGWHWDDCWVKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2C=O)F)F |
Computed by PubChem (NCBI)