Products 1823322-95-7
CAS 1823322-95-7 is the registry number for 1-(4-bromo-3-methoxyphenyl)-2,2,2-trifluoroethanone, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(4-bromo-3-methoxyphenyl)-2,2,2-trifluoroethanone (CAS 1823322-95-7) is a chemical compound with the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. IUPAC name: 1-(4-bromo-3-methoxyphenyl)-2,2,2-trifluoroethanone. InChIKey: STOQOONXPXQGTK-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O2 |
|---|---|
| Molecular weight | 283.04 g/mol |
| IUPAC name | 1-(4-bromo-3-methoxyphenyl)-2,2,2-trifluoroethanone |
| InChIKey | STOQOONXPXQGTK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)C(F)(F)F)Br |
Computed by PubChem (NCBI)