Products 1823323-06-3
CAS 1823323-06-3 appears in our catalog under these names: 1-(4-Bromo-3-fluorophenyl)-2,2-difluoroethan-1-one, 98%, 1-(4-Bromo-3-fluorophenyl)-2,2-difluoroethan-1-one, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
1-(4-bromo-3-fluorophenyl)-2,2-difluoroethanone (CAS 1823323-06-3) is a chemical compound with the molecular formula C8H4BrF3O and a molecular weight of 253.02 g/mol. IUPAC name: 1-(4-bromo-3-fluorophenyl)-2,2-difluoroethanone. InChIKey: IBXGOAIGNIZXNF-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O |
|---|---|
| Molecular weight | 253.02 g/mol |
| IUPAC name | 1-(4-bromo-3-fluorophenyl)-2,2-difluoroethanone |
| InChIKey | IBXGOAIGNIZXNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)F)F)Br |
Computed by PubChem (NCBI)