CAS 1823422-95-2 appears in our catalog under these names: 5-Chloro-1,6,8-triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene, 95%, 5-Chloro-1,6,8-triazatricyclo(7.2.1.0,2,7)dodeca-2,4,6-triene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (CAS 1823422-95-2) is a chemical compound with the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. IUPAC name: 5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene. InChIKey: LYFKZCRHQOGULQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3 |
|---|---|
| Molecular weight | 195.65 g/mol |
| IUPAC name | 5-chloro-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| InChIKey | LYFKZCRHQOGULQ-UHFFFAOYSA-N |
| SMILES | C1CN2CC1NC3=C2C=CC(=N3)Cl |
Computed by PubChem (NCBI)