CAS 1823503-36-1 is the registry number for tert-Butyl N-(2-cyclopropyl-1,3-thiazol-4-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl N-(2-cyclopropyl-1,3-thiazol-4-yl)carbamate (CAS 1823503-36-1) is a chemical compound with the molecular formula C11H16N2O2S and a molecular weight of 240.32 g/mol. IUPAC name: tert-butyl N-(2-cyclopropyl-1,3-thiazol-4-yl)carbamate. InChIKey: UZMYNTQODHVGEV-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O2S |
|---|---|
| Molecular weight | 240.32 g/mol |
| IUPAC name | tert-butyl N-(2-cyclopropyl-1,3-thiazol-4-yl)carbamate |
| InChIKey | UZMYNTQODHVGEV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CSC(=N1)C2CC2 |
Computed by PubChem (NCBI)