Products 1823548-53-3
CAS 1823548-53-3 is the registry number for Ethyl 3-bromothieno(3,2-c)pyridine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 3-bromothieno[3,2-c]pyridine-2-carboxylate (CAS 1823548-53-3) is a chemical compound with the molecular formula C10H8BrNO2S and a molecular weight of 286.15 g/mol. IUPAC name: ethyl 3-bromothieno[3,2-c]pyridine-2-carboxylate. InChIKey: QOOQRSRXALOFDX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO2S |
|---|---|
| Molecular weight | 286.15 g/mol |
| IUPAC name | ethyl 3-bromothieno[3,2-c]pyridine-2-carboxylate |
| InChIKey | QOOQRSRXALOFDX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(S1)C=CN=C2)Br |
Computed by PubChem (NCBI)