CAS 1823964-40-4 is the registry number for 5-Bromocinnoline, 95+%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
5-bromocinnoline (CAS 1823964-40-4) is a chemical compound with the molecular formula C8H5BrN2 and a molecular weight of 209.04 g/mol. IUPAC name: 5-bromocinnoline. InChIKey: RFPGSUNKMXQPKV-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2 |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 5-bromocinnoline |
| InChIKey | RFPGSUNKMXQPKV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=N2)C(=C1)Br |
Computed by PubChem (NCBI)