Products 1823965-11-2
CAS 1823965-11-2 is the registry number for (5,7-Difluoroquinolin-3-yl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5,7-difluoroquinolin-3-yl)methanol (CAS 1823965-11-2) is a chemical compound with the molecular formula C10H7F2NO and a molecular weight of 195.16 g/mol. IUPAC name: (5,7-difluoroquinolin-3-yl)methanol. InChIKey: CISRWJIAZMREOL-UHFFFAOYSA-N.
| Molecular formula | C10H7F2NO |
|---|---|
| Molecular weight | 195.16 g/mol |
| IUPAC name | (5,7-difluoroquinolin-3-yl)methanol |
| InChIKey | CISRWJIAZMREOL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=CC(=C2)CO)F)F |
Computed by PubChem (NCBI)