CAS 1824017-64-2 is the registry number for Ethyl 2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetate (CAS 1824017-64-2) is a chemical compound with the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. IUPAC name: ethyl 2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetate. InChIKey: NKERQHQPCSUMOK-UHFFFAOYSA-N.
| Molecular formula | C10H8BrF3O2 |
|---|---|
| Molecular weight | 297.07 g/mol |
| IUPAC name | ethyl 2-(4-bromo-3-fluorophenyl)-2,2-difluoroacetate |
| InChIKey | NKERQHQPCSUMOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=C(C=C1)Br)F)(F)F |
Computed by PubChem (NCBI)