Products 1824051-08-2
CAS 1824051-08-2 is the registry number for 4-Bromo-8-nitrochroman, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-8-nitro-3,4-dihydro-2H-chromene (CAS 1824051-08-2) is a chemical compound with the molecular formula C9H8BrNO3 and a molecular weight of 258.07 g/mol. IUPAC name: 4-bromo-8-nitro-3,4-dihydro-2H-chromene. InChIKey: HATMQGAMZAJBND-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO3 |
|---|---|
| Molecular weight | 258.07 g/mol |
| IUPAC name | 4-bromo-8-nitro-3,4-dihydro-2H-chromene |
| InChIKey | HATMQGAMZAJBND-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1Br)C=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)