Products 1824073-30-4
CAS 1824073-30-4 is the registry number for Methyl 2-amino-2,3-dihydro-1H-indene-5-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,05g, 0,1g, 0,25g, 0,5g, 1g.
Methyl 2-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride (CAS 1824073-30-4) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 2-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride. InChIKey: PPTWLZCJJYQAKN-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 2-amino-2,3-dihydro-1H-indene-5-carboxylate;hydrochloride |
| InChIKey | PPTWLZCJJYQAKN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CC(C2)N)C=C1.Cl |
Computed by PubChem (NCBI)