Products 1824153-33-4
CAS 1824153-33-4 is the registry number for 4-{((tert-Butoxy)carbonyl)(methyl)amino}-3-hydroxy-2-methylbutanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-hydroxy-2-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 1824153-33-4) is a chemical compound with the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. IUPAC name: 3-hydroxy-2-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: DBICMCWEONDXFD-UHFFFAOYSA-N.
| Molecular formula | C11H21NO5 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 3-hydroxy-2-methyl-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | DBICMCWEONDXFD-UHFFFAOYSA-N |
| SMILES | CC(C(CN(C)C(=O)OC(C)(C)C)O)C(=O)O |
Computed by PubChem (NCBI)