CAS 1824274-11-4 is the registry number for 2-chloro-2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-chloro-2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone (CAS 1824274-11-4) is a chemical compound with the molecular formula C9H6ClF3O and a molecular weight of 222.59 g/mol. IUPAC name: 2-chloro-2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone. InChIKey: ICOQMKFZXABNNO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O |
|---|---|
| Molecular weight | 222.59 g/mol |
| IUPAC name | 2-chloro-2,2-difluoro-1-(2-fluoro-4-methylphenyl)ethanone |
| InChIKey | ICOQMKFZXABNNO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C(F)(F)Cl)F |
Computed by PubChem (NCBI)