Products 1824275-65-1
CAS 1824275-65-1 is the registry number for 4-((tert-Butoxy)carbonyl)-2-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-dihydroquinoxaline-6-carboxylic acid (CAS 1824275-65-1) is a chemical compound with the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-dihydroquinoxaline-6-carboxylic acid. InChIKey: JUTXFWVLDGCGDS-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O5 |
|---|---|
| Molecular weight | 292.29 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonyl]-2-oxo-1,3-dihydroquinoxaline-6-carboxylic acid |
| InChIKey | JUTXFWVLDGCGDS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)NC2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)