Products 1824411-98-4
CAS 1824411-98-4 appears in our catalog under these names: 2-(tert-Butoxycarbonyl)isoindoline-5,6-dicarboxylic acid, 98%, 98%, 2-(tert-Butoxycarbonyl)isoindoline-5,6-dicarboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole-5,6-dicarboxylic acid (CAS 1824411-98-4) is a chemical compound with the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole-5,6-dicarboxylic acid. InChIKey: WRYFDMIWBNZSSN-UHFFFAOYSA-N.
| Molecular formula | C15H17NO6 |
|---|---|
| Molecular weight | 307.30 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-dihydroisoindole-5,6-dicarboxylic acid |
| InChIKey | WRYFDMIWBNZSSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC(=C(C=C2C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)