Products 1824534-79-3

CAS 1824534-79-3 is the registry number for Suvorexant Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-methyl-5-(triazol-2-yl)benzoic acid (CAS 1824534-79-3) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 3-methyl-5-(triazol-2-yl)benzoic acid. InChIKey: MWOAPFRRABHLOM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9N3O2
Molecular weight203.20 g/mol
IUPAC name3-methyl-5-(triazol-2-yl)benzoic acid
InChIKeyMWOAPFRRABHLOM-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)N2N=CC=N2)C(=O)O

Computed by PubChem (NCBI)