CAS 1824626-98-3 is the registry number for Methyl 5-chloro-2-oxoindoline-6-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chloro-2-oxo-1,3-dihydroindole-6-carboxylate (CAS 1824626-98-3) is a chemical compound with the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. IUPAC name: methyl 5-chloro-2-oxo-1,3-dihydroindole-6-carboxylate. InChIKey: JTRYLHJNVRIYAG-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO3 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | methyl 5-chloro-2-oxo-1,3-dihydroindole-6-carboxylate |
| InChIKey | JTRYLHJNVRIYAG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2CC(=O)NC2=C1)Cl |
Computed by PubChem (NCBI)