CAS 1824826-75-6 is the registry number for Methyl 4-(2,4-difluorophenyl)but-3-enoate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (E)-4-(2,4-difluorophenyl)but-3-enoate (CAS 1824826-75-6) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: methyl (E)-4-(2,4-difluorophenyl)but-3-enoate. InChIKey: ZGBUGCBPHIAMBV-NSCUHMNNSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | methyl (E)-4-(2,4-difluorophenyl)but-3-enoate |
| InChIKey | ZGBUGCBPHIAMBV-NSCUHMNNSA-N |
| SMILES | COC(=O)C/C=C/C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)