Products 1860875-60-0

CAS 1860875-60-0 is the registry number for 2-(4-Cyclopropylphenyl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(4-cyclopropylphenyl)-2,2-difluoroacetic acid (CAS 1860875-60-0) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2-(4-cyclopropylphenyl)-2,2-difluoroacetic acid. InChIKey: XKZRFWREKPGCMR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10F2O2
Molecular weight212.19 g/mol
IUPAC name2-(4-cyclopropylphenyl)-2,2-difluoroacetic acid
InChIKeyXKZRFWREKPGCMR-UHFFFAOYSA-N
SMILESC1CC1C2=CC=C(C=C2)C(C(=O)O)(F)F

Computed by PubChem (NCBI)