CAS 165115-70-8 is the registry number for Posaconazole Impurity 79. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2,4-difluorophenyl)pent-4-enoic acid (CAS 165115-70-8) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 4-(2,4-difluorophenyl)pent-4-enoic acid. InChIKey: AEKBJBNRZGVHBJ-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 4-(2,4-difluorophenyl)pent-4-enoic acid |
| InChIKey | AEKBJBNRZGVHBJ-UHFFFAOYSA-N |
| SMILES | C=C(CCC(=O)O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)