Products 2592405-64-4

CAS 2592405-64-4 is the registry number for 3-Cyclopropyl-5-(difluoromethyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-cyclopropyl-5-(difluoromethyl)benzoic acid (CAS 2592405-64-4) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 3-cyclopropyl-5-(difluoromethyl)benzoic acid. InChIKey: YWVOBJLCTZUUQW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10F2O2
Molecular weight212.19 g/mol
IUPAC name3-cyclopropyl-5-(difluoromethyl)benzoic acid
InChIKeyYWVOBJLCTZUUQW-UHFFFAOYSA-N
SMILESC1CC1C2=CC(=CC(=C2)C(=O)O)C(F)F

Computed by PubChem (NCBI)