CAS 2592405-64-4 appears in our catalog under these names: 3-Cyclopropyl-5-(difluoromethyl)benzoic acid, 98%, 3-cyclopropyl-5-(difluoromethyl)benzoic acid, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
3-cyclopropyl-5-(difluoromethyl)benzoic acid (CAS 2592405-64-4) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 3-cyclopropyl-5-(difluoromethyl)benzoic acid. InChIKey: YWVOBJLCTZUUQW-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 3-cyclopropyl-5-(difluoromethyl)benzoic acid |
| InChIKey | YWVOBJLCTZUUQW-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=CC(=C2)C(=O)O)C(F)F |
Computed by PubChem (NCBI)