Products 1215754-00-9
CAS 1215754-00-9 appears in our catalog under these names: 1-(2,6-Difluorophenyl)cyclobutanecarboxylic acid, 95%, 1–(2，6–difluorophenyl)cyclobutane–1–carboxylic acid, 1-(2,6-Difluorophenyl)cyclobutanecarboxylic acid, 1-(2，6-difluorophenyl)cyclobutane-1-carboxylic acid, 95%, 95%, 1-(2,6-Difluorophenyl)cyclobutane-1-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
1-(2,6-difluorophenyl)cyclobutane-1-carboxylic acid (CAS 1215754-00-9) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 1-(2,6-difluorophenyl)cyclobutane-1-carboxylic acid. InChIKey: DYFCQGKQXNYJNN-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)cyclobutane-1-carboxylic acid |
| InChIKey | DYFCQGKQXNYJNN-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=C(C=CC=C2F)F)C(=O)O |
Computed by PubChem (NCBI)