Products 1563329-67-8
CAS 1563329-67-8 is the registry number for Methyl (2e)-3-(3,4-difluorophenyl)but-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
Methyl (E)-3-(3,4-difluorophenyl)but-2-enoate (CAS 1563329-67-8) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: methyl (E)-3-(3,4-difluorophenyl)but-2-enoate. InChIKey: XWZRLYGFHCWYCC-FNORWQNLSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | methyl (E)-3-(3,4-difluorophenyl)but-2-enoate |
| InChIKey | XWZRLYGFHCWYCC-FNORWQNLSA-N |
| SMILES | C/C(=C\C(=O)OC)/C1=CC(=C(C=C1)F)F |
Computed by PubChem (NCBI)