Products 1826026-00-9
CAS 1826026-00-9 is the registry number for ML404. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(5-chloro-2-methylphenyl)-5-(3-hydroxyphenyl)-1,2-oxazole-3-carboxamide (CAS 1826026-00-9) is a chemical compound with the molecular formula C17H13ClN2O3 and a molecular weight of 328.7 g/mol. IUPAC name: N-(5-chloro-2-methylphenyl)-5-(3-hydroxyphenyl)-1,2-oxazole-3-carboxamide. InChIKey: IGFGYIMMNXHPFY-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O3 |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | N-(5-chloro-2-methylphenyl)-5-(3-hydroxyphenyl)-1,2-oxazole-3-carboxamide |
| InChIKey | IGFGYIMMNXHPFY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)NC(=O)C2=NOC(=C2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)