Products 65854-77-5
CAS 65854-77-5 appears in our catalog under these names: Oxazepam-d5 Acetate, Oxazepam acetate-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, Get quote.
[7-chloro-2-oxo-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate (CAS 65854-77-5) is a chemical compound with the molecular formula C17H13ClN2O3 and a molecular weight of 333.8 g/mol. IUPAC name: [7-chloro-2-oxo-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate. InChIKey: FYRWUTOZBRWYCS-VIQYUKPQSA-N.
| Molecular formula | C17H13ClN2O3 |
|---|---|
| Molecular weight | 333.8 g/mol |
| IUPAC name | [7-chloro-2-oxo-5-(2,3,4,5,6-pentadeuteriophenyl)-1,3-dihydro-1,4-benzodiazepin-3-yl] acetate |
| InChIKey | FYRWUTOZBRWYCS-VIQYUKPQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=NC(C(=O)NC3=C2C=C(C=C3)Cl)OC(=O)C)[2H])[2H] |
Computed by PubChem (NCBI)