Products 1860894-38-7
CAS 1860894-38-7 is the registry number for Methyl 2-((5-chloro-1-oxoisoquinolin-2(1H)-yl)methyl)isonicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(5-chloro-1-oxoisoquinolin-2-yl)methyl]pyridine-4-carboxylate (CAS 1860894-38-7) is a chemical compound with the molecular formula C17H13ClN2O3 and a molecular weight of 328.7 g/mol. IUPAC name: methyl 2-[(5-chloro-1-oxoisoquinolin-2-yl)methyl]pyridine-4-carboxylate. InChIKey: BBNFVFBPSCMIJY-UHFFFAOYSA-N.
| Molecular formula | C17H13ClN2O3 |
|---|---|
| Molecular weight | 328.7 g/mol |
| IUPAC name | methyl 2-[(5-chloro-1-oxoisoquinolin-2-yl)methyl]pyridine-4-carboxylate |
| InChIKey | BBNFVFBPSCMIJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC=C1)CN2C=CC3=C(C2=O)C=CC=C3Cl |
Computed by PubChem (NCBI)